C12H18N2O6S — CID 107213748
methyl 3-[(5-amino-2-methoxy-4-methylphenyl)sulfonylamino]-2-hydroxypropanoate (PubChem CID 107213748) has the molecular formula C12H18N2O6S and a molecular weight of 318.35 g/mol. Its IUPAC name is methyl 3-[(5-amino-2-methoxy-4-methylphenyl)sulfonylamino]-2-hydroxypropanoate.
| Compound Name | methyl 3-[(5-amino-2-methoxy-4-methylphenyl)sulfonylamino]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 107213748 |
| Molecular Formula | C12H18N2O6S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | methyl 3-[(5-amino-2-methoxy-4-methylphenyl)sulfonylamino]-2-hydroxypropanoate |
| SMILES | COC(=O)C(O)CNS(=O)(=O)c1cc(N)c(C)cc1OC |
| InChI | InChI=1S/C12H18N2O6S/c1-7-4-10(19-2)11(5-8(7)13)21(17,18)14-6-9(15)12(16)20-3/h4-5,9,14-15H,6,13H2,1-3H3 |
| InChIKey | PAPNIYRTMOTVJZ-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|