C13H21N3O4S — CID 106274875
3-[(5-amino-2-methoxy-4-methylphenyl)sulfonylamino]-2,2-dimethylpropanamide (PubChem CID 106274875) has the molecular formula C13H21N3O4S and a molecular weight of 315.40 g/mol. Its IUPAC name is 3-[(5-amino-2-methoxy-4-methylphenyl)sulfonylamino]-2,2-dimethylpropanamide.
| Compound Name | 3-[(5-amino-2-methoxy-4-methylphenyl)sulfonylamino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 106274875 |
| Molecular Formula | C13H21N3O4S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 3-[(5-amino-2-methoxy-4-methylphenyl)sulfonylamino]-2,2-dimethylpropanamide |
| SMILES | COc1cc(C)c(N)cc1S(=O)(=O)NCC(C)(C)C(N)=O |
| InChI | InChI=1S/C13H21N3O4S/c1-8-5-10(20-4)11(6-9(8)14)21(18,19)16-7-13(2,3)12(15)17/h5-6,16H,7,14H2,1-4H3,(H2,15,17) |
| InChIKey | KZEYLDOADSLRKK-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|