C11H16F2N2O5S — CID 106165551
5-amino-N-(2,2-difluoro-3-hydroxypropyl)-2,4-dimethoxybenzenesulfonamide (PubChem CID 106165551) has the molecular formula C11H16F2N2O5S and a molecular weight of 326.32 g/mol. Its IUPAC name is 5-amino-N-(2,2-difluoro-3-hydroxypropyl)-2,4-dimethoxybenzenesulfonamide.
| Compound Name | 5-amino-N-(2,2-difluoro-3-hydroxypropyl)-2,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 106165551 |
| Molecular Formula | C11H16F2N2O5S |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 5-amino-N-(2,2-difluoro-3-hydroxypropyl)-2,4-dimethoxybenzenesulfonamide |
| SMILES | COc1cc(OC)c(S(=O)(=O)NCC(F)(F)CO)cc1N |
| InChI | InChI=1S/C11H16F2N2O5S/c1-19-8-4-9(20-2)10(3-7(8)14)21(17,18)15-5-11(12,13)6-16/h3-4,15-16H,5-6,14H2,1-2H3 |
| InChIKey | WXIUJYZSICPFGM-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|