C10H13F3N2O4S — CID 102945869
5-amino-2,4-dimethoxy-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 102945869) has the molecular formula C10H13F3N2O4S and a molecular weight of 314.29 g/mol. Its IUPAC name is 5-amino-2,4-dimethoxy-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | 5-amino-2,4-dimethoxy-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 102945869 |
| Molecular Formula | C10H13F3N2O4S |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 5-amino-2,4-dimethoxy-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | COc1cc(OC)c(S(=O)(=O)NCC(F)(F)F)cc1N |
| InChI | InChI=1S/C10H13F3N2O4S/c1-18-7-4-8(19-2)9(3-6(7)14)20(16,17)15-5-10(11,12)13/h3-4,15H,5,14H2,1-2H3 |
| InChIKey | WZXRAQYRLINGHG-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|