C13H21BrN2O3S — CID 103460098
5-amino-4-bromo-N-(2,2-dimethylbutyl)-2-methoxybenzenesulfonamide (PubChem CID 103460098) has the molecular formula C13H21BrN2O3S and a molecular weight of 365.29 g/mol. Its IUPAC name is 5-amino-4-bromo-N-(2,2-dimethylbutyl)-2-methoxybenzenesulfonamide.
| Compound Name | 5-amino-4-bromo-N-(2,2-dimethylbutyl)-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 103460098 |
| Molecular Formula | C13H21BrN2O3S |
| Molecular Weight | 365.29 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 5-amino-4-bromo-N-(2,2-dimethylbutyl)-2-methoxybenzenesulfonamide |
| SMILES | CCC(C)(C)CNS(=O)(=O)c1cc(N)c(Br)cc1OC |
| InChI | InChI=1S/C13H21BrN2O3S/c1-5-13(2,3)8-16-20(17,18)12-7-10(15)9(14)6-11(12)19-4/h6-7,16H,5,8,15H2,1-4H3 |
| InChIKey | PPDGAIDADMPHMH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|