C9H13BrN2O3S — CID 81414565
5-amino-4-bromo-N-ethyl-2-methoxybenzenesulfonamide (PubChem CID 81414565) has the molecular formula C9H13BrN2O3S and a molecular weight of 309.19 g/mol. Its IUPAC name is 5-amino-4-bromo-N-ethyl-2-methoxybenzenesulfonamide.
| Compound Name | 5-amino-4-bromo-N-ethyl-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 81414565 |
| Molecular Formula | C9H13BrN2O3S |
| Molecular Weight | 309.19 g/mol |
| Exact Mass | 307.98 |
| IUPAC Name | 5-amino-4-bromo-N-ethyl-2-methoxybenzenesulfonamide |
| SMILES | CCNS(=O)(=O)c1cc(N)c(Br)cc1OC |
| InChI | InChI=1S/C9H13BrN2O3S/c1-3-12-16(13,14)9-5-7(11)6(10)4-8(9)15-2/h4-5,12H,3,11H2,1-2H3 |
| InChIKey | YRSAOTWPFFJYCV-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.19 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|