C10H13BrN2O3S — CID 81414818
5-amino-4-bromo-2-methoxy-N-prop-2-enylbenzenesulfonamide (PubChem CID 81414818) has the molecular formula C10H13BrN2O3S and a molecular weight of 321.20 g/mol. Its IUPAC name is 5-amino-4-bromo-2-methoxy-N-prop-2-enylbenzenesulfonamide.
| Compound Name | 5-amino-4-bromo-2-methoxy-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 81414818 |
| Molecular Formula | C10H13BrN2O3S |
| Molecular Weight | 321.20 g/mol |
| Exact Mass | 319.98 |
| IUPAC Name | 5-amino-4-bromo-2-methoxy-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCNS(=O)(=O)c1cc(N)c(Br)cc1OC |
| InChI | InChI=1S/C10H13BrN2O3S/c1-3-4-13-17(14,15)10-6-8(12)7(11)5-9(10)16-2/h3,5-6,13H,1,4,12H2,2H3 |
| InChIKey | MXGFRHFYKLUCOO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.20 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|