C13H22N2O5S — CID 102946119
5-amino-N-(2-hydroxypentyl)-2,4-dimethoxybenzenesulfonamide (PubChem CID 102946119) has the molecular formula C13H22N2O5S and a molecular weight of 318.40 g/mol. Its IUPAC name is 5-amino-N-(2-hydroxypentyl)-2,4-dimethoxybenzenesulfonamide.
| Compound Name | 5-amino-N-(2-hydroxypentyl)-2,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 102946119 |
| Molecular Formula | C13H22N2O5S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 5-amino-N-(2-hydroxypentyl)-2,4-dimethoxybenzenesulfonamide |
| SMILES | CCCC(O)CNS(=O)(=O)c1cc(N)c(OC)cc1OC |
| InChI | InChI=1S/C13H22N2O5S/c1-4-5-9(16)8-15-21(17,18)13-6-10(14)11(19-2)7-12(13)20-3/h6-7,9,15-16H,4-5,8,14H2,1-3H3 |
| InChIKey | WMTYWCWANQDMSD-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|