C12H18N2O6S — CID 115754448
N-(2-hydroxypentyl)-2-methoxy-4-nitrobenzenesulfonamide (PubChem CID 115754448) has the molecular formula C12H18N2O6S and a molecular weight of 318.35 g/mol. Its IUPAC name is N-(2-hydroxypentyl)-2-methoxy-4-nitrobenzenesulfonamide.
| Compound Name | N-(2-hydroxypentyl)-2-methoxy-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 115754448 |
| Molecular Formula | C12H18N2O6S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | N-(2-hydroxypentyl)-2-methoxy-4-nitrobenzenesulfonamide |
| SMILES | CCCC(O)CNS(=O)(=O)c1ccc([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C12H18N2O6S/c1-3-4-10(15)8-13-21(18,19)12-6-5-9(14(16)17)7-11(12)20-2/h5-7,10,13,15H,3-4,8H2,1-2H3 |
| InChIKey | IYSZNOKPZVYXDB-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|