C11H14N4O5S — CID 106392075
5-amino-2,4-dimethoxy-N-(1,2,4-oxadiazol-3-ylmethyl)benzenesulfonamide (PubChem CID 106392075) has the molecular formula C11H14N4O5S and a molecular weight of 314.32 g/mol. Its IUPAC name is 5-amino-2,4-dimethoxy-N-(1,2,4-oxadiazol-3-ylmethyl)benzenesulfonamide.
| Compound Name | 5-amino-2,4-dimethoxy-N-(1,2,4-oxadiazol-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106392075 |
| Molecular Formula | C11H14N4O5S |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 5-amino-2,4-dimethoxy-N-(1,2,4-oxadiazol-3-ylmethyl)benzenesulfonamide |
| SMILES | COc1cc(OC)c(S(=O)(=O)NCc2ncon2)cc1N |
| InChI | InChI=1S/C11H14N4O5S/c1-18-8-4-9(19-2)10(3-7(8)12)21(16,17)14-5-11-13-6-20-15-11/h3-4,6,14H,5,12H2,1-2H3 |
| InChIKey | CGYHBPAERNJOQL-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 129.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|