C10H10N4O5S — CID 106392086
3-amino-4-(1,2,4-oxadiazol-3-ylmethylsulfamoyl)benzoic acid (PubChem CID 106392086) has the molecular formula C10H10N4O5S and a molecular weight of 298.28 g/mol. Its IUPAC name is 3-amino-4-(1,2,4-oxadiazol-3-ylmethylsulfamoyl)benzoic acid.
| Compound Name | 3-amino-4-(1,2,4-oxadiazol-3-ylmethylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 106392086 |
| Molecular Formula | C10H10N4O5S |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 3-amino-4-(1,2,4-oxadiazol-3-ylmethylsulfamoyl)benzoic acid |
| SMILES | Nc1cc(C(=O)O)ccc1S(=O)(=O)NCc1ncon1 |
| InChI | InChI=1S/C10H10N4O5S/c11-7-3-6(10(15)16)1-2-8(7)20(17,18)13-4-9-12-5-19-14-9/h1-3,5,13H,4,11H2,(H,15,16) |
| InChIKey | TUZODGVAEDEUFG-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 148.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|