C9H8BrFN4O3S — CID 106392188
5-amino-2-bromo-4-fluoro-N-(1,2,4-oxadiazol-3-ylmethyl)benzenesulfonamide (PubChem CID 106392188) has the molecular formula C9H8BrFN4O3S and a molecular weight of 351.16 g/mol. Its IUPAC name is 5-amino-2-bromo-4-fluoro-N-(1,2,4-oxadiazol-3-ylmethyl)benzenesulfonamide.
| Compound Name | 5-amino-2-bromo-4-fluoro-N-(1,2,4-oxadiazol-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106392188 |
| Molecular Formula | C9H8BrFN4O3S |
| Molecular Weight | 351.16 g/mol |
| Exact Mass | 349.95 |
| IUPAC Name | 5-amino-2-bromo-4-fluoro-N-(1,2,4-oxadiazol-3-ylmethyl)benzenesulfonamide |
| SMILES | Nc1cc(S(=O)(=O)NCc2ncon2)c(Br)cc1F |
| InChI | InChI=1S/C9H8BrFN4O3S/c10-5-1-6(11)7(12)2-8(5)19(16,17)14-3-9-13-4-18-15-9/h1-2,4,14H,3,12H2 |
| InChIKey | MQUYKGLYJJELTR-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.16 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|