C9H9ClN4O3S — CID 106392142
2-amino-5-chloro-N-(1,2,4-oxadiazol-3-ylmethyl)benzenesulfonamide (PubChem CID 106392142) has the molecular formula C9H9ClN4O3S and a molecular weight of 288.72 g/mol. Its IUPAC name is 2-amino-5-chloro-N-(1,2,4-oxadiazol-3-ylmethyl)benzenesulfonamide.
| Compound Name | 2-amino-5-chloro-N-(1,2,4-oxadiazol-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106392142 |
| Molecular Formula | C9H9ClN4O3S |
| Molecular Weight | 288.72 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | 2-amino-5-chloro-N-(1,2,4-oxadiazol-3-ylmethyl)benzenesulfonamide |
| SMILES | Nc1ccc(Cl)cc1S(=O)(=O)NCc1ncon1 |
| InChI | InChI=1S/C9H9ClN4O3S/c10-6-1-2-7(11)8(3-6)18(15,16)13-4-9-12-5-17-14-9/h1-3,5,13H,4,11H2 |
| InChIKey | MORPNCKDSFITJF-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.72 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|