C11H12ClN3O3S — CID 106369128
2-amino-5-chloro-N-[(5-methyl-1,3-oxazol-2-yl)methyl]benzenesulfonamide (PubChem CID 106369128) has the molecular formula C11H12ClN3O3S and a molecular weight of 301.76 g/mol. Its IUPAC name is 2-amino-5-chloro-N-[(5-methyl-1,3-oxazol-2-yl)methyl]benzenesulfonamide.
| Compound Name | 2-amino-5-chloro-N-[(5-methyl-1,3-oxazol-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106369128 |
| Molecular Formula | C11H12ClN3O3S |
| Molecular Weight | 301.76 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 2-amino-5-chloro-N-[(5-methyl-1,3-oxazol-2-yl)methyl]benzenesulfonamide |
| SMILES | Cc1cnc(CNS(=O)(=O)c2cc(Cl)ccc2N)o1 |
| InChI | InChI=1S/C11H12ClN3O3S/c1-7-5-14-11(18-7)6-15-19(16,17)10-4-8(12)2-3-9(10)13/h2-5,15H,6,13H2,1H3 |
| InChIKey | VQXBKLJVTZJFKD-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.76 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|