C10H11FN4O3S — CID 106392187
5-amino-2-fluoro-4-methyl-N-(1,2,4-oxadiazol-3-ylmethyl)benzenesulfonamide (PubChem CID 106392187) has the molecular formula C10H11FN4O3S and a molecular weight of 286.29 g/mol. Its IUPAC name is 5-amino-2-fluoro-4-methyl-N-(1,2,4-oxadiazol-3-ylmethyl)benzenesulfonamide.
| Compound Name | 5-amino-2-fluoro-4-methyl-N-(1,2,4-oxadiazol-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106392187 |
| Molecular Formula | C10H11FN4O3S |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 5-amino-2-fluoro-4-methyl-N-(1,2,4-oxadiazol-3-ylmethyl)benzenesulfonamide |
| SMILES | Cc1cc(F)c(S(=O)(=O)NCc2ncon2)cc1N |
| InChI | InChI=1S/C10H11FN4O3S/c1-6-2-7(11)9(3-8(6)12)19(16,17)14-4-10-13-5-18-15-10/h2-3,5,14H,4,12H2,1H3 |
| InChIKey | KWDZOHMEQKOTJR-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|