C9H10N4O3S — CID 114182887
3-amino-N-(1,2,4-oxadiazol-3-ylmethyl)benzenesulfonamide (PubChem CID 114182887) has the molecular formula C9H10N4O3S and a molecular weight of 254.27 g/mol. Its IUPAC name is 3-amino-N-(1,2,4-oxadiazol-3-ylmethyl)benzenesulfonamide.
| Compound Name | 3-amino-N-(1,2,4-oxadiazol-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 114182887 |
| Molecular Formula | C9H10N4O3S |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 3-amino-N-(1,2,4-oxadiazol-3-ylmethyl)benzenesulfonamide |
| SMILES | Nc1cccc(S(=O)(=O)NCc2ncon2)c1 |
| InChI | InChI=1S/C9H10N4O3S/c10-7-2-1-3-8(4-7)17(14,15)12-5-9-11-6-16-13-9/h1-4,6,12H,5,10H2 |
| InChIKey | YSUDKJFEWPSTTD-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|