C10H13N5O2S — CID 104868500
3-amino-N-[(1-methyl-1,2,4-triazol-3-yl)methyl]benzenesulfonamide (PubChem CID 104868500) has the molecular formula C10H13N5O2S and a molecular weight of 267.31 g/mol. Its IUPAC name is 3-amino-N-[(1-methyl-1,2,4-triazol-3-yl)methyl]benzenesulfonamide.
| Compound Name | 3-amino-N-[(1-methyl-1,2,4-triazol-3-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 104868500 |
| Molecular Formula | C10H13N5O2S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 3-amino-N-[(1-methyl-1,2,4-triazol-3-yl)methyl]benzenesulfonamide |
| SMILES | Cn1cnc(CNS(=O)(=O)c2cccc(N)c2)n1 |
| InChI | InChI=1S/C10H13N5O2S/c1-15-7-12-10(14-15)6-13-18(16,17)9-4-2-3-8(11)5-9/h2-5,7,13H,6,11H2,1H3 |
| InChIKey | XVOHDUUICDZITI-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|