C9H11F3N2O3S — CID 29033942
5-amino-2-methoxy-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 29033942) has the molecular formula C9H11F3N2O3S and a molecular weight of 284.26 g/mol. Its IUPAC name is 5-amino-2-methoxy-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | 5-amino-2-methoxy-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 29033942 |
| Molecular Formula | C9H11F3N2O3S |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 5-amino-2-methoxy-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | COc1ccc(N)cc1S(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C9H11F3N2O3S/c1-17-7-3-2-6(13)4-8(7)18(15,16)14-5-9(10,11)12/h2-4,14H,5,13H2,1H3 |
| InChIKey | QTFNLFFFXANCPI-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|