C8H8F3N3O4S — CID 62148379
4-amino-2-nitro-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 62148379) has the molecular formula C8H8F3N3O4S and a molecular weight of 299.23 g/mol. Its IUPAC name is 4-amino-2-nitro-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | 4-amino-2-nitro-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 62148379 |
| Molecular Formula | C8H8F3N3O4S |
| Molecular Weight | 299.23 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 4-amino-2-nitro-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)NCC(F)(F)F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H8F3N3O4S/c9-8(10,11)4-13-19(17,18)7-2-1-5(12)3-6(7)14(15)16/h1-3,13H,4,12H2 |
| InChIKey | CMYHDMJIQRTOLS-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|