C8H9F3N2O2S — CID 4962703
4-amino-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 4962703) has the molecular formula C8H9F3N2O2S and a molecular weight of 254.23 g/mol. Its IUPAC name is 4-amino-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | 4-amino-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 4962703 |
| Molecular Formula | C8H9F3N2O2S |
| Molecular Weight | 254.23 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 4-amino-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C8H9F3N2O2S/c9-8(10,11)5-13-16(14,15)7-3-1-6(12)2-4-7/h1-4,13H,5,12H2 |
| InChIKey | CSMJYCQMIGKRQO-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.23 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|