C8H8F3NO3S — CID 43135522
4-hydroxy-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 43135522) has the molecular formula C8H8F3NO3S and a molecular weight of 255.22 g/mol. Its IUPAC name is 4-hydroxy-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | 4-hydroxy-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 43135522 |
| Molecular Formula | C8H8F3NO3S |
| Molecular Weight | 255.22 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | 4-hydroxy-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC(F)(F)F)c1ccc(O)cc1 |
| InChI | InChI=1S/C8H8F3NO3S/c9-8(10,11)5-12-16(14,15)7-3-1-6(13)2-4-7/h1-4,12-13H,5H2 |
| InChIKey | JMNPGDAFUCUBQN-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |