C14H12F4N2O4S2 — CID 26267865
2-fluoro-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]benzenesulfonamide (PubChem CID 26267865) has the molecular formula C14H12F4N2O4S2 and a molecular weight of 412.39 g/mol. Its IUPAC name is 2-fluoro-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]benzenesulfonamide.
| Compound Name | 2-fluoro-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 26267865 |
| Molecular Formula | C14H12F4N2O4S2 |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | 2-fluoro-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCC(F)(F)F)c1ccc(NS(=O)(=O)c2ccccc2F)cc1 |
| InChI | InChI=1S/C14H12F4N2O4S2/c15-12-3-1-2-4-13(12)26(23,24)20-10-5-7-11(8-6-10)25(21,22)19-9-14(16,17)18/h1-8,19-20H,9H2 |
| InChIKey | SPVFCBUEGNENKM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |