C16H17F3N2O4S2 — CID 26267871
3,4-dimethyl-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]benzenesulfonamide (PubChem CID 26267871) has the molecular formula C16H17F3N2O4S2 and a molecular weight of 422.45 g/mol. Its IUPAC name is 3,4-dimethyl-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]benzenesulfonamide.
| Compound Name | 3,4-dimethyl-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 26267871 |
| Molecular Formula | C16H17F3N2O4S2 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | 3,4-dimethyl-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(S(=O)(=O)NCC(F)(F)F)cc2)cc1C |
| InChI | InChI=1S/C16H17F3N2O4S2/c1-11-3-6-15(9-12(11)2)27(24,25)21-13-4-7-14(8-5-13)26(22,23)20-10-16(17,18)19/h3-9,20-21H,10H2,1-2H3 |
| InChIKey | UPEWUCWUGJPKBS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |