C18H24N2O4S2 — CID 2696950
N-[4-(diethylsulfamoyl)phenyl]-3,4-dimethylbenzenesulfonamide (PubChem CID 2696950) has the molecular formula C18H24N2O4S2 and a molecular weight of 396.53 g/mol. Its IUPAC name is N-[4-(diethylsulfamoyl)phenyl]-3,4-dimethylbenzenesulfonamide.
| Compound Name | N-[4-(diethylsulfamoyl)phenyl]-3,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 2696950 |
| Molecular Formula | C18H24N2O4S2 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | N-[4-(diethylsulfamoyl)phenyl]-3,4-dimethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NS(=O)(=O)c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C18H24N2O4S2/c1-5-20(6-2)26(23,24)17-11-8-16(9-12-17)19-25(21,22)18-10-7-14(3)15(4)13-18/h7-13,19H,5-6H2,1-4H3 |
| InChIKey | LMEULPZHUWOZPJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |