C19H26N2O5S2 — CID 100528166
N-[4-(diethylsulfamoyl)phenyl]-4-methoxy-2,5-dimethylbenzenesulfonamide (PubChem CID 100528166) has the molecular formula C19H26N2O5S2 and a molecular weight of 426.56 g/mol. Its IUPAC name is N-[4-(diethylsulfamoyl)phenyl]-4-methoxy-2,5-dimethylbenzenesulfonamide.
| Compound Name | N-[4-(diethylsulfamoyl)phenyl]-4-methoxy-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 100528166 |
| Molecular Formula | C19H26N2O5S2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | N-[4-(diethylsulfamoyl)phenyl]-4-methoxy-2,5-dimethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NS(=O)(=O)c2cc(C)c(OC)cc2C)cc1 |
| InChI | InChI=1S/C19H26N2O5S2/c1-6-21(7-2)28(24,25)17-10-8-16(9-11-17)20-27(22,23)19-13-14(3)18(26-5)12-15(19)4/h8-13,20H,6-7H2,1-5H3 |
| InChIKey | VDYFQAWPDQBDJV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |