C17H20Cl2N2O5S2 — CID 1295972
2,3-dichloro-N-[4-(diethylsulfamoyl)phenyl]-4-methoxybenzenesulfonamide (PubChem CID 1295972) has the molecular formula C17H20Cl2N2O5S2 and a molecular weight of 467.40 g/mol. Its IUPAC name is 2,3-dichloro-N-[4-(diethylsulfamoyl)phenyl]-4-methoxybenzenesulfonamide.
| Compound Name | 2,3-dichloro-N-[4-(diethylsulfamoyl)phenyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 1295972 |
| Molecular Formula | C17H20Cl2N2O5S2 |
| Molecular Weight | 467.40 g/mol |
| Exact Mass | 466.02 |
| IUPAC Name | 2,3-dichloro-N-[4-(diethylsulfamoyl)phenyl]-4-methoxybenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NS(=O)(=O)c2ccc(OC)c(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C17H20Cl2N2O5S2/c1-4-21(5-2)28(24,25)13-8-6-12(7-9-13)20-27(22,23)15-11-10-14(26-3)16(18)17(15)19/h6-11,20H,4-5H2,1-3H3 |
| InChIKey | CZAYXYJSZOGOKM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |