C15H21ClN4O4S2 — CID 55730964
5-chloro-N-[4-(diethylsulfamoyl)phenyl]-1,3-dimethylpyrazole-4-sulfonamide (PubChem CID 55730964) has the molecular formula C15H21ClN4O4S2 and a molecular weight of 420.94 g/mol. Its IUPAC name is 5-chloro-N-[4-(diethylsulfamoyl)phenyl]-1,3-dimethylpyrazole-4-sulfonamide.
| Compound Name | 5-chloro-N-[4-(diethylsulfamoyl)phenyl]-1,3-dimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 55730964 |
| Molecular Formula | C15H21ClN4O4S2 |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 5-chloro-N-[4-(diethylsulfamoyl)phenyl]-1,3-dimethylpyrazole-4-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NS(=O)(=O)c2c(C)nn(C)c2Cl)cc1 |
| InChI | InChI=1S/C15H21ClN4O4S2/c1-5-20(6-2)26(23,24)13-9-7-12(8-10-13)18-25(21,22)14-11(3)17-19(4)15(14)16/h7-10,18H,5-6H2,1-4H3 |
| InChIKey | YQRYXANXSAYMFG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |