C10H11ClN4O2S — CID 25038632
5-chloro-1,3-dimethyl-N-pyridin-3-ylpyrazole-4-sulfonamide (PubChem CID 25038632) has the molecular formula C10H11ClN4O2S and a molecular weight of 286.74 g/mol. Its IUPAC name is 5-chloro-1,3-dimethyl-N-pyridin-3-ylpyrazole-4-sulfonamide.
| Compound Name | 5-chloro-1,3-dimethyl-N-pyridin-3-ylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 25038632 |
| Molecular Formula | C10H11ClN4O2S |
| Molecular Weight | 286.74 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 5-chloro-1,3-dimethyl-N-pyridin-3-ylpyrazole-4-sulfonamide |
| SMILES | Cc1nn(C)c(Cl)c1S(=O)(=O)Nc1cccnc1 |
| InChI | InChI=1S/C10H11ClN4O2S/c1-7-9(10(11)15(2)13-7)18(16,17)14-8-4-3-5-12-6-8/h3-6,14H,1-2H3 |
| InChIKey | KHHAXWZTBNVISD-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.74 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |