C11H13ClN4O2S — CID 114051879
N-(4-chloro-3-pyridinyl)-1,3,5-trimethylpyrazole-4-sulfonamide (PubChem CID 114051879) has the molecular formula C11H13ClN4O2S and a molecular weight of 300.77 g/mol. Its IUPAC name is N-(4-chloro-3-pyridinyl)-1,3,5-trimethylpyrazole-4-sulfonamide.
| Compound Name | N-(4-chloro-3-pyridinyl)-1,3,5-trimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 114051879 |
| Molecular Formula | C11H13ClN4O2S |
| Molecular Weight | 300.77 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | N-(4-chloro-3-pyridinyl)-1,3,5-trimethylpyrazole-4-sulfonamide |
| SMILES | Cc1nn(C)c(C)c1S(=O)(=O)Nc1cnccc1Cl |
| InChI | InChI=1S/C11H13ClN4O2S/c1-7-11(8(2)16(3)14-7)19(17,18)15-10-6-13-5-4-9(10)12/h4-6,15H,1-3H3 |
| InChIKey | LPWPOLBSRNYVLZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.77 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |