C12H14ClN3O3S — CID 62062450
N-(5-chloro-2-hydroxyphenyl)-1,3,5-trimethylpyrazole-4-sulfonamide (PubChem CID 62062450) has the molecular formula C12H14ClN3O3S and a molecular weight of 315.78 g/mol. Its IUPAC name is N-(5-chloro-2-hydroxyphenyl)-1,3,5-trimethylpyrazole-4-sulfonamide.
| Compound Name | N-(5-chloro-2-hydroxyphenyl)-1,3,5-trimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 62062450 |
| Molecular Formula | C12H14ClN3O3S |
| Molecular Weight | 315.78 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | N-(5-chloro-2-hydroxyphenyl)-1,3,5-trimethylpyrazole-4-sulfonamide |
| SMILES | Cc1nn(C)c(C)c1S(=O)(=O)Nc1cc(Cl)ccc1O |
| InChI | InChI=1S/C12H14ClN3O3S/c1-7-12(8(2)16(3)14-7)20(18,19)15-10-6-9(13)4-5-11(10)17/h4-6,15,17H,1-3H3 |
| InChIKey | BMNCLMQADJLFQF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.78 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|