C12H13Br2N3O2S — CID 22773601
N-(2,4-dibromophenyl)-1,3,5-trimethylpyrazole-4-sulfonamide (PubChem CID 22773601) has the molecular formula C12H13Br2N3O2S and a molecular weight of 423.13 g/mol. Its IUPAC name is N-(2,4-dibromophenyl)-1,3,5-trimethylpyrazole-4-sulfonamide.
| Compound Name | N-(2,4-dibromophenyl)-1,3,5-trimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 22773601 |
| Molecular Formula | C12H13Br2N3O2S |
| Molecular Weight | 423.13 g/mol |
| Exact Mass | 420.91 |
| IUPAC Name | N-(2,4-dibromophenyl)-1,3,5-trimethylpyrazole-4-sulfonamide |
| SMILES | Cc1nn(C)c(C)c1S(=O)(=O)Nc1ccc(Br)cc1Br |
| InChI | InChI=1S/C12H13Br2N3O2S/c1-7-12(8(2)17(3)15-7)20(18,19)16-11-5-4-9(13)6-10(11)14/h4-6,16H,1-3H3 |
| InChIKey | WNHFARRZGVUIMF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.13 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |