C12H15BrN4O2S — CID 62064019
N-(4-amino-2-bromophenyl)-1,3,5-trimethylpyrazole-4-sulfonamide (PubChem CID 62064019) has the molecular formula C12H15BrN4O2S and a molecular weight of 359.25 g/mol. Its IUPAC name is N-(4-amino-2-bromophenyl)-1,3,5-trimethylpyrazole-4-sulfonamide.
| Compound Name | N-(4-amino-2-bromophenyl)-1,3,5-trimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 62064019 |
| Molecular Formula | C12H15BrN4O2S |
| Molecular Weight | 359.25 g/mol |
| Exact Mass | 358.01 |
| IUPAC Name | N-(4-amino-2-bromophenyl)-1,3,5-trimethylpyrazole-4-sulfonamide |
| SMILES | Cc1nn(C)c(C)c1S(=O)(=O)Nc1ccc(N)cc1Br |
| InChI | InChI=1S/C12H15BrN4O2S/c1-7-12(8(2)17(3)15-7)20(18,19)16-11-5-4-9(14)6-10(11)13/h4-6,16H,14H2,1-3H3 |
| InChIKey | ISUXZGKUEDFTJD-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.25 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|