C18H18ClN5O3S — CID 55731026
1-[3-[(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonylamino]phenyl]-3-phenylurea (PubChem CID 55731026) has the molecular formula C18H18ClN5O3S and a molecular weight of 419.89 g/mol. Its IUPAC name is 1-[3-[(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonylamino]phenyl]-3-phenylurea.
| Compound Name | 1-[3-[(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonylamino]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 55731026 |
| Molecular Formula | C18H18ClN5O3S |
| Molecular Weight | 419.89 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 1-[3-[(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonylamino]phenyl]-3-phenylurea |
| SMILES | Cc1nn(C)c(Cl)c1S(=O)(=O)Nc1cccc(NC(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C18H18ClN5O3S/c1-12-16(17(19)24(2)22-12)28(26,27)23-15-10-6-9-14(11-15)21-18(25)20-13-7-4-3-5-8-13/h3-11,23H,1-2H3,(H2,20,21,25) |
| InChIKey | ZDBVWPCRBWQBSB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.89 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |