C19H16ClN3O4S — CID 138041549
1-[3-[(3-chloro-2-hydroxyphenyl)sulfonylamino]phenyl]-3-phenylurea (PubChem CID 138041549) has the molecular formula C19H16ClN3O4S and a molecular weight of 417.87 g/mol. Its IUPAC name is 1-[3-[(3-chloro-2-hydroxyphenyl)sulfonylamino]phenyl]-3-phenylurea.
| Compound Name | 1-[3-[(3-chloro-2-hydroxyphenyl)sulfonylamino]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 138041549 |
| Molecular Formula | C19H16ClN3O4S |
| Molecular Weight | 417.87 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | 1-[3-[(3-chloro-2-hydroxyphenyl)sulfonylamino]phenyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1cccc(NS(=O)(=O)c2cccc(Cl)c2O)c1 |
| InChI | InChI=1S/C19H16ClN3O4S/c20-16-10-5-11-17(18(16)24)28(26,27)23-15-9-4-8-14(12-15)22-19(25)21-13-6-2-1-3-7-13/h1-12,23-24H,(H2,21,22,25) |
| InChIKey | KOKTUUJOKBAXDI-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.87 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |