C17H14BrN3O3S2 — CID 31075750
1-[3-[(5-bromothiophen-2-yl)sulfonylamino]phenyl]-3-phenylurea (PubChem CID 31075750) has the molecular formula C17H14BrN3O3S2 and a molecular weight of 452.36 g/mol. Its IUPAC name is 1-[3-[(5-bromothiophen-2-yl)sulfonylamino]phenyl]-3-phenylurea.
| Compound Name | 1-[3-[(5-bromothiophen-2-yl)sulfonylamino]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 31075750 |
| Molecular Formula | C17H14BrN3O3S2 |
| Molecular Weight | 452.36 g/mol |
| Exact Mass | 450.97 |
| IUPAC Name | 1-[3-[(5-bromothiophen-2-yl)sulfonylamino]phenyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1cccc(NS(=O)(=O)c2ccc(Br)s2)c1 |
| InChI | InChI=1S/C17H14BrN3O3S2/c18-15-9-10-16(25-15)26(23,24)21-14-8-4-7-13(11-14)20-17(22)19-12-5-2-1-3-6-12/h1-11,21H,(H2,19,20,22) |
| InChIKey | DRYHKBDSPHFHTD-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.36 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |