C13H12BrNO2S4 — CID 27658375
5-bromo-N-[3-(1,3-dithiolan-2-yl)phenyl]thiophene-2-sulfonamide (PubChem CID 27658375) has the molecular formula C13H12BrNO2S4 and a molecular weight of 422.42 g/mol. Its IUPAC name is 5-bromo-N-[3-(1,3-dithiolan-2-yl)phenyl]thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-[3-(1,3-dithiolan-2-yl)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 27658375 |
| Molecular Formula | C13H12BrNO2S4 |
| Molecular Weight | 422.42 g/mol |
| Exact Mass | 420.89 |
| IUPAC Name | 5-bromo-N-[3-(1,3-dithiolan-2-yl)phenyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1cccc(C2SCCS2)c1)c1ccc(Br)s1 |
| InChI | InChI=1S/C13H12BrNO2S4/c14-11-4-5-12(20-11)21(16,17)15-10-3-1-2-9(8-10)13-18-6-7-19-13/h1-5,8,13,15H,6-7H2 |
| InChIKey | AXGZEAIYIZOGKP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.42 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |