C15H17NO2S4 — CID 71890365
N-[3-(1,3-dithiolan-2-yl)phenyl]-5-ethylthiophene-2-sulfonamide (PubChem CID 71890365) has the molecular formula C15H17NO2S4 and a molecular weight of 371.57 g/mol. Its IUPAC name is N-[3-(1,3-dithiolan-2-yl)phenyl]-5-ethylthiophene-2-sulfonamide.
| Compound Name | N-[3-(1,3-dithiolan-2-yl)phenyl]-5-ethylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 71890365 |
| Molecular Formula | C15H17NO2S4 |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | N-[3-(1,3-dithiolan-2-yl)phenyl]-5-ethylthiophene-2-sulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)Nc2cccc(C3SCCS3)c2)s1 |
| InChI | InChI=1S/C15H17NO2S4/c1-2-13-6-7-14(21-13)22(17,18)16-12-5-3-4-11(10-12)15-19-8-9-20-15/h3-7,10,15-16H,2,8-9H2,1H3 |
| InChIKey | NTGCQGDAJFGLDU-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |