C12H11Cl2NO2S2 — CID 113098917
N-(3,5-dichlorophenyl)-5-ethylthiophene-2-sulfonamide (PubChem CID 113098917) has the molecular formula C12H11Cl2NO2S2 and a molecular weight of 336.27 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-5-ethylthiophene-2-sulfonamide.
| Compound Name | N-(3,5-dichlorophenyl)-5-ethylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113098917 |
| Molecular Formula | C12H11Cl2NO2S2 |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 334.96 |
| IUPAC Name | N-(3,5-dichlorophenyl)-5-ethylthiophene-2-sulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)Nc2cc(Cl)cc(Cl)c2)s1 |
| InChI | InChI=1S/C12H11Cl2NO2S2/c1-2-11-3-4-12(18-11)19(16,17)15-10-6-8(13)5-9(14)7-10/h3-7,15H,2H2,1H3 |
| InChIKey | BRWRPOZSISQDOR-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |