C14H14Cl2N2O3S2 — CID 113001388
N-(3,5-dichlorophenyl)-2-[(5-ethylthiophen-2-yl)sulfonylamino]acetamide (PubChem CID 113001388) has the molecular formula C14H14Cl2N2O3S2 and a molecular weight of 393.32 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-2-[(5-ethylthiophen-2-yl)sulfonylamino]acetamide.
| Compound Name | N-(3,5-dichlorophenyl)-2-[(5-ethylthiophen-2-yl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 113001388 |
| Molecular Formula | C14H14Cl2N2O3S2 |
| Molecular Weight | 393.32 g/mol |
| Exact Mass | 391.98 |
| IUPAC Name | N-(3,5-dichlorophenyl)-2-[(5-ethylthiophen-2-yl)sulfonylamino]acetamide |
| SMILES | CCc1ccc(S(=O)(=O)NCC(=O)Nc2cc(Cl)cc(Cl)c2)s1 |
| InChI | InChI=1S/C14H14Cl2N2O3S2/c1-2-12-3-4-14(22-12)23(20,21)17-8-13(19)18-11-6-9(15)5-10(16)7-11/h3-7,17H,2,8H2,1H3,(H,18,19) |
| InChIKey | WQGRDOJYQBZEEH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.32 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |