C13H13ClN2O3S2 — CID 112997887
N-(3-chlorophenyl)-2-[(5-methylthiophen-2-yl)sulfonylamino]acetamide (PubChem CID 112997887) has the molecular formula C13H13ClN2O3S2 and a molecular weight of 344.85 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[(5-methylthiophen-2-yl)sulfonylamino]acetamide.
| Compound Name | N-(3-chlorophenyl)-2-[(5-methylthiophen-2-yl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 112997887 |
| Molecular Formula | C13H13ClN2O3S2 |
| Molecular Weight | 344.85 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | N-(3-chlorophenyl)-2-[(5-methylthiophen-2-yl)sulfonylamino]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC(=O)Nc2cccc(Cl)c2)s1 |
| InChI | InChI=1S/C13H13ClN2O3S2/c1-9-5-6-13(20-9)21(18,19)15-8-12(17)16-11-4-2-3-10(14)7-11/h2-7,15H,8H2,1H3,(H,16,17) |
| InChIKey | IYCYWTFDUBLNMZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.85 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |