C12H10BrClN2O3S2 — CID 15999318
2-[(5-bromothiophen-2-yl)sulfonylamino]-N-(4-chlorophenyl)acetamide (PubChem CID 15999318) has the molecular formula C12H10BrClN2O3S2 and a molecular weight of 409.71 g/mol. Its IUPAC name is 2-[(5-bromothiophen-2-yl)sulfonylamino]-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-[(5-bromothiophen-2-yl)sulfonylamino]-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 15999318 |
| Molecular Formula | C12H10BrClN2O3S2 |
| Molecular Weight | 409.71 g/mol |
| Exact Mass | 407.90 |
| IUPAC Name | 2-[(5-bromothiophen-2-yl)sulfonylamino]-N-(4-chlorophenyl)acetamide |
| SMILES | O=C(CNS(=O)(=O)c1ccc(Br)s1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H10BrClN2O3S2/c13-10-5-6-12(20-10)21(18,19)15-7-11(17)16-9-3-1-8(14)2-4-9/h1-6,15H,7H2,(H,16,17) |
| InChIKey | IKHLXSGBVITONP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.71 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |