C11H15BrN2O5S2 — CID 51131047
methyl 2-[[2-[(5-bromothiophen-2-yl)sulfonylamino]acetyl]amino]-2-methylpropanoate (PubChem CID 51131047) has the molecular formula C11H15BrN2O5S2 and a molecular weight of 399.29 g/mol. Its IUPAC name is methyl 2-[[2-[(5-bromothiophen-2-yl)sulfonylamino]acetyl]amino]-2-methylpropanoate.
| Compound Name | methyl 2-[[2-[(5-bromothiophen-2-yl)sulfonylamino]acetyl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 51131047 |
| Molecular Formula | C11H15BrN2O5S2 |
| Molecular Weight | 399.29 g/mol |
| Exact Mass | 397.96 |
| IUPAC Name | methyl 2-[[2-[(5-bromothiophen-2-yl)sulfonylamino]acetyl]amino]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)NC(=O)CNS(=O)(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C11H15BrN2O5S2/c1-11(2,10(16)19-3)14-8(15)6-13-21(17,18)9-5-4-7(12)20-9/h4-5,13H,6H2,1-3H3,(H,14,15) |
| InChIKey | FMCNDTJMNILCDE-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.29 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |