C11H16BrN3O3S2 — CID 119376871
N-[2-(4-aminopiperidin-1-yl)-2-oxoethyl]-5-bromothiophene-2-sulfonamide (PubChem CID 119376871) has the molecular formula C11H16BrN3O3S2 and a molecular weight of 382.31 g/mol. Its IUPAC name is N-[2-(4-aminopiperidin-1-yl)-2-oxoethyl]-5-bromothiophene-2-sulfonamide.
| Compound Name | N-[2-(4-aminopiperidin-1-yl)-2-oxoethyl]-5-bromothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 119376871 |
| Molecular Formula | C11H16BrN3O3S2 |
| Molecular Weight | 382.31 g/mol |
| Exact Mass | 380.98 |
| IUPAC Name | N-[2-(4-aminopiperidin-1-yl)-2-oxoethyl]-5-bromothiophene-2-sulfonamide |
| SMILES | NC1CCN(C(=O)CNS(=O)(=O)c2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C11H16BrN3O3S2/c12-9-1-2-11(19-9)20(17,18)14-7-10(16)15-5-3-8(13)4-6-15/h1-2,8,14H,3-7,13H2 |
| InChIKey | ATEGWAIPRAJFFM-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.31 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |