C9H13BrN2O3S2 — CID 9189604
2-[(5-bromothiophen-2-yl)sulfonylamino]-N-propan-2-ylacetamide (PubChem CID 9189604) has the molecular formula C9H13BrN2O3S2 and a molecular weight of 341.25 g/mol. Its IUPAC name is 2-[(5-bromothiophen-2-yl)sulfonylamino]-N-propan-2-ylacetamide.
| Compound Name | 2-[(5-bromothiophen-2-yl)sulfonylamino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 9189604 |
| Molecular Formula | C9H13BrN2O3S2 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 339.96 |
| IUPAC Name | 2-[(5-bromothiophen-2-yl)sulfonylamino]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CNS(=O)(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C9H13BrN2O3S2/c1-6(2)12-8(13)5-11-17(14,15)9-4-3-7(10)16-9/h3-4,6,11H,5H2,1-2H3,(H,12,13) |
| InChIKey | ABRLTZPHTBUAIX-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |