C10H16BrN3O3S2 — CID 112991518
2-[(5-bromothiophen-2-yl)sulfonylamino]-N-[2-(dimethylamino)ethyl]acetamide (PubChem CID 112991518) has the molecular formula C10H16BrN3O3S2 and a molecular weight of 370.29 g/mol. Its IUPAC name is 2-[(5-bromothiophen-2-yl)sulfonylamino]-N-[2-(dimethylamino)ethyl]acetamide.
| Compound Name | 2-[(5-bromothiophen-2-yl)sulfonylamino]-N-[2-(dimethylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 112991518 |
| Molecular Formula | C10H16BrN3O3S2 |
| Molecular Weight | 370.29 g/mol |
| Exact Mass | 368.98 |
| IUPAC Name | 2-[(5-bromothiophen-2-yl)sulfonylamino]-N-[2-(dimethylamino)ethyl]acetamide |
| SMILES | CN(C)CCNC(=O)CNS(=O)(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C10H16BrN3O3S2/c1-14(2)6-5-12-9(15)7-13-19(16,17)10-4-3-8(11)18-10/h3-4,13H,5-7H2,1-2H3,(H,12,15) |
| InChIKey | PXQUXGOVWZLYLC-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.29 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |