C14H23N3O3S — CID 112991485
N-[2-(dimethylamino)ethyl]-2-[(4-ethylphenyl)sulfonylamino]acetamide (PubChem CID 112991485) has the molecular formula C14H23N3O3S and a molecular weight of 313.42 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-2-[(4-ethylphenyl)sulfonylamino]acetamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-2-[(4-ethylphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 112991485 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-2-[(4-ethylphenyl)sulfonylamino]acetamide |
| SMILES | CCc1ccc(S(=O)(=O)NCC(=O)NCCN(C)C)cc1 |
| InChI | InChI=1S/C14H23N3O3S/c1-4-12-5-7-13(8-6-12)21(19,20)16-11-14(18)15-9-10-17(2)3/h5-8,16H,4,9-11H2,1-3H3,(H,15,18) |
| InChIKey | UBXZVDMICNBSKD-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |