C20H27N3O3S — CID 109060317
4-[3-(dimethylamino)propylsulfamoyl]-N-(4-ethylphenyl)benzamide (PubChem CID 109060317) has the molecular formula C20H27N3O3S and a molecular weight of 389.52 g/mol. Its IUPAC name is 4-[3-(dimethylamino)propylsulfamoyl]-N-(4-ethylphenyl)benzamide.
| Compound Name | 4-[3-(dimethylamino)propylsulfamoyl]-N-(4-ethylphenyl)benzamide |
|---|---|
| PubChem CID | 109060317 |
| Molecular Formula | C20H27N3O3S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 4-[3-(dimethylamino)propylsulfamoyl]-N-(4-ethylphenyl)benzamide |
| SMILES | CCc1ccc(NC(=O)c2ccc(S(=O)(=O)NCCCN(C)C)cc2)cc1 |
| InChI | InChI=1S/C20H27N3O3S/c1-4-16-6-10-18(11-7-16)22-20(24)17-8-12-19(13-9-17)27(25,26)21-14-5-15-23(2)3/h6-13,21H,4-5,14-15H2,1-3H3,(H,22,24) |
| InChIKey | YANKCMNEKGUASI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|