C17H19F2N3O3S — CID 109060210
N-(3,4-difluorophenyl)-4-[2-(dimethylamino)ethylsulfamoyl]benzamide (PubChem CID 109060210) has the molecular formula C17H19F2N3O3S and a molecular weight of 383.42 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-4-[2-(dimethylamino)ethylsulfamoyl]benzamide.
| Compound Name | N-(3,4-difluorophenyl)-4-[2-(dimethylamino)ethylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 109060210 |
| Molecular Formula | C17H19F2N3O3S |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | N-(3,4-difluorophenyl)-4-[2-(dimethylamino)ethylsulfamoyl]benzamide |
| SMILES | CN(C)CCNS(=O)(=O)c1ccc(C(=O)Nc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C17H19F2N3O3S/c1-22(2)10-9-20-26(24,25)14-6-3-12(4-7-14)17(23)21-13-5-8-15(18)16(19)11-13/h3-8,11,20H,9-10H2,1-2H3,(H,21,23) |
| InChIKey | LJWWICRSLVXUBA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |