C18H14F2N2O4S — CID 9165761
N-(3,4-difluorophenyl)-4-(furan-2-ylmethylsulfamoyl)benzamide (PubChem CID 9165761) has the molecular formula C18H14F2N2O4S and a molecular weight of 392.38 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-4-(furan-2-ylmethylsulfamoyl)benzamide.
| Compound Name | N-(3,4-difluorophenyl)-4-(furan-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 9165761 |
| Molecular Formula | C18H14F2N2O4S |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | N-(3,4-difluorophenyl)-4-(furan-2-ylmethylsulfamoyl)benzamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1)c1ccc(S(=O)(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C18H14F2N2O4S/c19-16-8-5-13(10-17(16)20)22-18(23)12-3-6-15(7-4-12)27(24,25)21-11-14-2-1-9-26-14/h1-10,21H,11H2,(H,22,23) |
| InChIKey | CPIGSWNQZHJDET-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |