C23H27N3O6S2 — CID 5147041
N-[3-(diethylsulfamoyl)-4-methylphenyl]-4-(furan-2-ylmethylsulfamoyl)benzamide (PubChem CID 5147041) has the molecular formula C23H27N3O6S2 and a molecular weight of 505.62 g/mol. Its IUPAC name is N-[3-(diethylsulfamoyl)-4-methylphenyl]-4-(furan-2-ylmethylsulfamoyl)benzamide.
| Compound Name | N-[3-(diethylsulfamoyl)-4-methylphenyl]-4-(furan-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 5147041 |
| Molecular Formula | C23H27N3O6S2 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | N-[3-(diethylsulfamoyl)-4-methylphenyl]-4-(furan-2-ylmethylsulfamoyl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)c2ccc(S(=O)(=O)NCc3ccco3)cc2)ccc1C |
| InChI | InChI=1S/C23H27N3O6S2/c1-4-26(5-2)34(30,31)22-15-19(11-8-17(22)3)25-23(27)18-9-12-21(13-10-18)33(28,29)24-16-20-7-6-14-32-20/h6-15,24H,4-5,16H2,1-3H3,(H,25,27) |
| InChIKey | SYJDSXQAVKDGLS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |